C24H24O4 — CID 101066714
7,8,16,17-tetramethyl-3,12-dimethylidenetricyclo[12.4.0.05,10]octadeca-1(14),5(10),7,16-tetraene-6,9,15,18-tetrone (PubChem CID 101066714) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is 7,8,16,17-tetramethyl-3,12-dimethylidenetricyclo[12.4.0.05,10]octadeca-1(14),5(10),7,16-tetraene-6,9,15,18-tetrone.
| Compound Name | 7,8,16,17-tetramethyl-3,12-dimethylidenetricyclo[12.4.0.05,10]octadeca-1(14),5(10),7,16-tetraene-6,9,15,18-tetrone |
|---|---|
| PubChem CID | 101066714 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 7,8,16,17-tetramethyl-3,12-dimethylidenetricyclo[12.4.0.05,10]octadeca-1(14),5(10),7,16-tetraene-6,9,15,18-tetrone |
| SMILES | C=C1CC2=C(CC(=C)CC3=C(C1)C(=O)C(C)=C(C)C3=O)C(=O)C(C)=C(C)C2=O |
| InChI | InChI=1S/C24H24O4/c1-11-7-17-19(23(27)15(5)13(3)21(17)25)9-12(2)10-20-18(8-11)22(26)14(4)16(6)24(20)28/h1-2,7-10H2,3-6H3 |
| InChIKey | XKDXQMHYEHLWQO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|