C12H18O3 — CID 146417623
ethanol;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 146417623) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is ethanol;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | ethanol;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 146417623 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | ethanol;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C)=C(C)C1=O.CCO |
| InChI | InChI=1S/C10H12O2.C2H6O/c1-5-6(2)10(12)8(4)7(3)9(5)11;1-2-3/h1-4H3;3H,2H2,1H3 |
| InChIKey | SJRISWZLVCQVCD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|