C9H16O2 — CID 87292225
(E)-5-hydroxy-3,4-dimethylhept-3-en-2-one (PubChem CID 87292225) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (E)-5-hydroxy-3,4-dimethylhept-3-en-2-one.
| Compound Name | (E)-5-hydroxy-3,4-dimethylhept-3-en-2-one |
|---|---|
| PubChem CID | 87292225 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (E)-5-hydroxy-3,4-dimethylhept-3-en-2-one |
| SMILES | CCC(O)/C(C)=C(\C)C(C)=O |
| InChI | InChI=1S/C9H16O2/c1-5-9(11)7(3)6(2)8(4)10/h9,11H,5H2,1-4H3/b7-6+ |
| InChIKey | RKVOYIBZONGFEW-VOTSOKGWSA-N |
| XLogP | 1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|