C11H15N — CID 144586453
1-(2-methylcyclopenta-1,4-dien-1-yl)-N-[(Z)-prop-1-enyl]ethanimine (PubChem CID 144586453) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-(2-methylcyclopenta-1,4-dien-1-yl)-N-[(Z)-prop-1-enyl]ethanimine.
| Compound Name | 1-(2-methylcyclopenta-1,4-dien-1-yl)-N-[(Z)-prop-1-enyl]ethanimine |
|---|---|
| PubChem CID | 144586453 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1-(2-methylcyclopenta-1,4-dien-1-yl)-N-[(Z)-prop-1-enyl]ethanimine |
| SMILES | C/C=C\N=C(/C)C1=C(C)CC=C1 |
| InChI | InChI=1S/C11H15N/c1-4-8-12-10(3)11-7-5-6-9(11)2/h4-5,7-8H,6H2,1-3H3/b8-4-,12-10+ |
| InChIKey | KFCJOUUCGASNQC-DIXMKNLJSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|