C13H14FN — CID 144796412
1-(4-fluorocyclohepta-1,3,6-trien-1-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine (PubChem CID 144796412) has the molecular formula C13H14FN and a molecular weight of 203.26 g/mol. Its IUPAC name is 1-(4-fluorocyclohepta-1,3,6-trien-1-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine.
| Compound Name | 1-(4-fluorocyclohepta-1,3,6-trien-1-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 144796412 |
| Molecular Formula | C13H14FN |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(4-fluorocyclohepta-1,3,6-trien-1-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
| SMILES | C=C/C(=N\C=C/C)C1=CC=C(F)CC=C1 |
| InChI | InChI=1S/C13H14FN/c1-3-10-15-13(4-2)11-6-5-7-12(14)9-8-11/h3-6,8-10H,2,7H2,1H3/b10-3-,15-13+ |
| InChIKey | XMZNGROSJVVVTJ-DPGOPEAOSA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|