C9H14F3N — CID 145149506
ethane;1,1,1-trifluoro-N-[(Z)-prop-1-enyl]but-3-en-2-imine (PubChem CID 145149506) has the molecular formula C9H14F3N and a molecular weight of 193.21 g/mol. Its IUPAC name is ethane;1,1,1-trifluoro-N-[(Z)-prop-1-enyl]but-3-en-2-imine.
| Compound Name | ethane;1,1,1-trifluoro-N-[(Z)-prop-1-enyl]but-3-en-2-imine |
|---|---|
| PubChem CID | 145149506 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethane;1,1,1-trifluoro-N-[(Z)-prop-1-enyl]but-3-en-2-imine |
| SMILES | C=C/C(=N\C=C/C)C(F)(F)F.CC |
| InChI | InChI=1S/C7H8F3N.C2H6/c1-3-5-11-6(4-2)7(8,9)10;1-2/h3-5H,2H2,1H3;1-2H3/b5-3-,11-6+; |
| InChIKey | HLFOVZBDYFOJCQ-GHFGPCLASA-N |
| XLogP | 3.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|