C12H21F3N2 — CID 145136554
ethane;prop-1-ene;2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide (PubChem CID 145136554) has the molecular formula C12H21F3N2 and a molecular weight of 250.31 g/mol. Its IUPAC name is ethane;prop-1-ene;2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide.
| Compound Name | ethane;prop-1-ene;2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide |
|---|---|
| PubChem CID | 145136554 |
| Molecular Formula | C12H21F3N2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethane;prop-1-ene;2,2,2-trifluoro-N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide |
| SMILES | C=CC.C=N/C(=N\C=C(C)C)C(F)(F)F.CC |
| InChI | InChI=1S/C7H9F3N2.C3H6.C2H6/c1-5(2)4-12-6(11-3)7(8,9)10;1-3-2;1-2/h4H,3H2,1-2H3;3H,1H2,2H3;1-2H3/b12-6-;; |
| InChIKey | ZCXMIMAOUFKCMP-AXAVVADUSA-N |
| XLogP | 4.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|