C15H20N2 — CID 126560090
2,2-dimethyl-N-methylidene-N'-[(E)-2-phenylprop-1-enyl]propanimidamide (PubChem CID 126560090) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2,2-dimethyl-N-methylidene-N'-[(E)-2-phenylprop-1-enyl]propanimidamide.
| Compound Name | 2,2-dimethyl-N-methylidene-N'-[(E)-2-phenylprop-1-enyl]propanimidamide |
|---|---|
| PubChem CID | 126560090 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2,2-dimethyl-N-methylidene-N'-[(E)-2-phenylprop-1-enyl]propanimidamide |
| SMILES | C=N/C(=N\C=C(/C)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H20N2/c1-12(13-9-7-6-8-10-13)11-17-14(16-5)15(2,3)4/h6-11H,5H2,1-4H3/b12-11+,17-14- |
| InChIKey | IDZDFFHEYISAFP-VPJURZAQSA-N |
| XLogP | 4.19 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|