C15H19F — CID 170149907
(5-fluoro-2,5-dimethyl-4-methylidenehex-2-en-3-yl)benzene (PubChem CID 170149907) has the molecular formula C15H19F and a molecular weight of 218.31 g/mol. Its IUPAC name is (5-fluoro-2,5-dimethyl-4-methylidenehex-2-en-3-yl)benzene.
| Compound Name | (5-fluoro-2,5-dimethyl-4-methylidenehex-2-en-3-yl)benzene |
|---|---|
| PubChem CID | 170149907 |
| Molecular Formula | C15H19F |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (5-fluoro-2,5-dimethyl-4-methylidenehex-2-en-3-yl)benzene |
| SMILES | C=C(C(=C(C)C)c1ccccc1)C(C)(C)F |
| InChI | InChI=1S/C15H19F/c1-11(2)14(12(3)15(4,5)16)13-9-7-6-8-10-13/h6-10H,3H2,1-2,4-5H3 |
| InChIKey | GZJHZIREIKMYPB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|