About 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene
1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene (PubChem CID 166438756) has the molecular formula C17H15F3
and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene.
Molecular Properties
| Compound Name | 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene |
| PubChem CID | 166438756 |
| Molecular Formula | C17H15F3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene |
| SMILES | CC(C)=C(c1ccc(-c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H15F3/c1-12(2)16(17(18,19)20)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-11H,1-2H3 |
| InChIKey | UCNYSTWCCGGHJU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene?
The IUPAC name of 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene (CID 166438756) is 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene.
What is the SMILES notation for 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene?
The canonical SMILES for 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene is CC(C)=C(c1ccc(-c2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene?
The InChIKey is UCNYSTWCCGGHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3/c1-12(2)16(17(18,19)20)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-11H,1-2H3.
What are the key properties of 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene?
1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene has a molecular weight of 276.30 g/mol, XLogP of 5.71, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)benzene is sourced from PubChem (CID 166438756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).