C13H14F4O — CID 10825346
[(E)-1,3,3,3-tetrafluoro-1-[(2-methylpropan-2-yl)oxy]prop-1-en-2-yl]benzene (PubChem CID 10825346) has the molecular formula C13H14F4O and a molecular weight of 262.25 g/mol. Its IUPAC name is [(E)-1,3,3,3-tetrafluoro-1-[(2-methylpropan-2-yl)oxy]prop-1-en-2-yl]benzene.
| Compound Name | [(E)-1,3,3,3-tetrafluoro-1-[(2-methylpropan-2-yl)oxy]prop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 10825346 |
| Molecular Formula | C13H14F4O |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [(E)-1,3,3,3-tetrafluoro-1-[(2-methylpropan-2-yl)oxy]prop-1-en-2-yl]benzene |
| SMILES | CC(C)(C)O/C(F)=C(/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H14F4O/c1-12(2,3)18-11(14)10(13(15,16)17)9-7-5-4-6-8-9/h4-8H,1-3H3/b11-10- |
| InChIKey | PAYBWXTXOYVWHB-KHPPLWFESA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|