C21H15F3O2S — CID 11025526
[(E)-1-(benzenesulfonyl)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]benzene (PubChem CID 11025526) has the molecular formula C21H15F3O2S and a molecular weight of 388.41 g/mol. Its IUPAC name is [(E)-1-(benzenesulfonyl)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]benzene.
| Compound Name | [(E)-1-(benzenesulfonyl)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 11025526 |
| Molecular Formula | C21H15F3O2S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [(E)-1-(benzenesulfonyl)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]benzene |
| SMILES | O=S(=O)(/C(=C(\c1ccccc1)C(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15F3O2S/c22-21(23,24)19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)27(25,26)18-14-8-3-9-15-18/h1-15H/b20-19+ |
| InChIKey | LYLWMRAARASJLS-FMQUCBEESA-N |
| XLogP | 5.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|