C16H11F3O5S2 — CID 11177157
4,4-bis(benzenesulfonyl)-1,1,1-trifluorobut-3-en-2-one (PubChem CID 11177157) has the molecular formula C16H11F3O5S2 and a molecular weight of 404.39 g/mol. Its IUPAC name is 4,4-bis(benzenesulfonyl)-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | 4,4-bis(benzenesulfonyl)-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 11177157 |
| Molecular Formula | C16H11F3O5S2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 4,4-bis(benzenesulfonyl)-1,1,1-trifluorobut-3-en-2-one |
| SMILES | O=C(C=C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H11F3O5S2/c17-16(18,19)14(20)11-15(25(21,22)12-7-3-1-4-8-12)26(23,24)13-9-5-2-6-10-13/h1-11H |
| InChIKey | SVLPZZVZYOKNTM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|