C20H12F6O2PtS2 — CID 5376687
platinum(2+);bis((Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-ene-1-thiolate) (PubChem CID 5376687) has the molecular formula C20H12F6O2PtS2 and a molecular weight of 657.51 g/mol. Its IUPAC name is platinum(2+);bis((Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-ene-1-thiolate).
| Compound Name | platinum(2+);bis((Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-ene-1-thiolate) |
|---|---|
| PubChem CID | 5376687 |
| Molecular Formula | C20H12F6O2PtS2 |
| Molecular Weight | 657.51 g/mol |
| Exact Mass | 656.98 |
| IUPAC Name | platinum(2+);bis((Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-ene-1-thiolate) |
| SMILES | O=C(/C=C(\[S-])c1ccccc1)C(F)(F)F.O=C(/C=C(\[S-])c1ccccc1)C(F)(F)F.[Pt+2] |
| InChI | InChI=1S/2C10H7F3OS.Pt/c2*11-10(12,13)9(14)6-8(15)7-4-2-1-3-5-7;/h2*1-6,15H;/q;;+2/p-2/b2*8-6-; |
| InChIKey | FWIDYZNZXORHAK-HIGYRTBYSA-L |
| XLogP | 5.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|