C27H21F3O5S2Se — CID 10952281
[(Z)-2-(benzenesulfonyl)-2-phenylethenyl]-diphenylselanium;trifluoromethanesulfonate (PubChem CID 10952281) has the molecular formula C27H21F3O5S2Se and a molecular weight of 625.55 g/mol. Its IUPAC name is [(Z)-2-(benzenesulfonyl)-2-phenylethenyl]-diphenylselanium;trifluoromethanesulfonate.
| Compound Name | [(Z)-2-(benzenesulfonyl)-2-phenylethenyl]-diphenylselanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10952281 |
| Molecular Formula | C27H21F3O5S2Se |
| Molecular Weight | 625.55 g/mol |
| Exact Mass | 625.99 |
| IUPAC Name | [(Z)-2-(benzenesulfonyl)-2-phenylethenyl]-diphenylselanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)(/C(=C\[Se+](c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C26H21O2SSe.CHF3O3S/c27-29(28,23-15-7-2-8-16-23)26(22-13-5-1-6-14-22)21-30(24-17-9-3-10-18-24)25-19-11-4-12-20-25;2-1(3,4)8(5,6)7/h1-21H;(H,5,6,7)/q+1;/p-1/b26-21-; |
| InChIKey | RVEACNKHJGRVGO-AURQPEIRSA-M |
| XLogP | 4.40 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|