C11H10F3NO — CID 141454955
4,4,4-trifluoro-3-methyl-2-phenylbut-2-enamide (PubChem CID 141454955) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-methyl-2-phenylbut-2-enamide.
| Compound Name | 4,4,4-trifluoro-3-methyl-2-phenylbut-2-enamide |
|---|---|
| PubChem CID | 141454955 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4,4,4-trifluoro-3-methyl-2-phenylbut-2-enamide |
| SMILES | CC(=C(C(N)=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO/c1-7(11(12,13)14)9(10(15)16)8-5-3-2-4-6-8/h2-6H,1H3,(H2,15,16) |
| InChIKey | GXVJHBCYXSVJLO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|