C11H19N — CID 156522568
2,4,4-trimethyl-N-[(Z)-prop-1-enyl]pent-1-en-3-imine (PubChem CID 156522568) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-[(Z)-prop-1-enyl]pent-1-en-3-imine.
| Compound Name | 2,4,4-trimethyl-N-[(Z)-prop-1-enyl]pent-1-en-3-imine |
|---|---|
| PubChem CID | 156522568 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2,4,4-trimethyl-N-[(Z)-prop-1-enyl]pent-1-en-3-imine |
| SMILES | C=C(C)/C(=N\C=C/C)C(C)(C)C |
| InChI | InChI=1S/C11H19N/c1-7-8-12-10(9(2)3)11(4,5)6/h7-8H,2H2,1,3-6H3/b8-7-,12-10+ |
| InChIKey | KITAVZQXTPRPTR-QOUMFGDESA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|