C14H26N6 — CID 154121266
2-[(1-amino-2-methyl-1-prop-1-enyliminopropan-2-yl)diazenyl]-2-methyl-N'-prop-1-enylpropanimidamide (PubChem CID 154121266) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[(1-amino-2-methyl-1-prop-1-enyliminopropan-2-yl)diazenyl]-2-methyl-N'-prop-1-enylpropanimidamide.
| Compound Name | 2-[(1-amino-2-methyl-1-prop-1-enyliminopropan-2-yl)diazenyl]-2-methyl-N'-prop-1-enylpropanimidamide |
|---|---|
| PubChem CID | 154121266 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2-[(1-amino-2-methyl-1-prop-1-enyliminopropan-2-yl)diazenyl]-2-methyl-N'-prop-1-enylpropanimidamide |
| SMILES | CC=C/N=C(\N)C(C)(C)/N=N/C(C)(C)/C(N)=N/C=CC |
| InChI | InChI=1S/C14H26N6/c1-7-9-17-11(15)13(3,4)19-20-14(5,6)12(16)18-10-8-2/h7-10H,1-6H3,(H2,15,17)(H2,16,18)/b9-7?,10-8?,20-19+ |
| InChIKey | BLVFIJKHYZOZNB-OCOAQKAFSA-N |
| XLogP | 2.78 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|