C8H20N6+2 — CID 24848207
[1-amino-2-[(1-amino-1-azaniumylidene-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium (PubChem CID 24848207) has the molecular formula C8H20N6+2 and a molecular weight of 200.29 g/mol. Its IUPAC name is [1-amino-2-[(1-amino-1-azaniumylidene-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium.
| Compound Name | [1-amino-2-[(1-amino-1-azaniumylidene-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium |
|---|---|
| PubChem CID | 24848207 |
| Molecular Formula | C8H20N6+2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | [1-amino-2-[(1-amino-1-azaniumylidene-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium |
| SMILES | CC(C)(/N=N/C(C)(C)C(N)=[NH2+])C(N)=[NH2+] |
| InChI | InChI=1S/C8H18N6/c1-7(2,5(9)10)13-14-8(3,4)6(11)12/h1-4H3,(H3,9,10)(H3,11,12)/p+2/b14-13+ |
| InChIKey | CCTFAOUOYLVUFG-BUHFOSPRSA-P |
| XLogP | -2.77 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|