C16H30N6O4 — CID 18795128
4-[[1-amino-2-[[1-amino-1-(3-carboxypropylimino)-2-methylpropan-2-yl]diazenyl]-2-methylpropylidene]amino]butanoic acid (PubChem CID 18795128) has the molecular formula C16H30N6O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[[1-amino-2-[[1-amino-1-(3-carboxypropylimino)-2-methylpropan-2-yl]diazenyl]-2-methylpropylidene]amino]butanoic acid.
| Compound Name | 4-[[1-amino-2-[[1-amino-1-(3-carboxypropylimino)-2-methylpropan-2-yl]diazenyl]-2-methylpropylidene]amino]butanoic acid |
|---|---|
| PubChem CID | 18795128 |
| Molecular Formula | C16H30N6O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 4-[[1-amino-2-[[1-amino-1-(3-carboxypropylimino)-2-methylpropan-2-yl]diazenyl]-2-methylpropylidene]amino]butanoic acid |
| SMILES | CC(C)(/N=N/C(C)(C)/C(N)=N/CCCC(=O)O)/C(N)=N/CCCC(=O)O |
| InChI | InChI=1S/C16H30N6O4/c1-15(2,13(17)19-9-5-7-11(23)24)21-22-16(3,4)14(18)20-10-6-8-12(25)26/h5-10H2,1-4H3,(H2,17,19)(H2,18,20)(H,23,24)(H,25,26)/b22-21+ |
| InChIKey | LHZDAXHOSBYRCC-QURGRASLSA-N |
| XLogP | 1.44 |
| TPSA | 176.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|