C11H24N6O4 — CID 87620190
6-(diaminomethylideneamino)hexanoic acid;methyl 2-(diaminomethylideneamino)acetate (PubChem CID 87620190) has the molecular formula C11H24N6O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 6-(diaminomethylideneamino)hexanoic acid;methyl 2-(diaminomethylideneamino)acetate.
| Compound Name | 6-(diaminomethylideneamino)hexanoic acid;methyl 2-(diaminomethylideneamino)acetate |
|---|---|
| PubChem CID | 87620190 |
| Molecular Formula | C11H24N6O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 6-(diaminomethylideneamino)hexanoic acid;methyl 2-(diaminomethylideneamino)acetate |
| SMILES | COC(=O)CN=C(N)N.NC(N)=NCCCCCC(=O)O |
| InChI | InChI=1S/C7H15N3O2.C4H9N3O2/c8-7(9)10-5-3-1-2-4-6(11)12;1-9-3(8)2-7-4(5)6/h1-5H2,(H,11,12)(H4,8,9,10);2H2,1H3,(H4,5,6,7) |
| InChIKey | WMEPGTTYQAWPNE-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 192.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|