About 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid
6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid (PubChem CID 144969972) has the molecular formula C13H28FN5O3
and a molecular weight of 321.40 g/mol. Its IUPAC name is 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid.
Molecular Properties
| Compound Name | 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid |
| PubChem CID | 144969972 |
| Molecular Formula | C13H28FN5O3 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CN(F)C(=O)CCCCCN.NC(N)=NCCCCC(=O)O |
| InChI | InChI=1S/C7H15FN2O.C6H13N3O2/c1-10(8)7(11)5-3-2-4-6-9;7-6(8)9-4-2-1-3-5(10)11/h2-6,9H2,1H3;1-4H2,(H,10,11)(H4,7,8,9) |
| InChIKey | LKQAHNYKLSUAOD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid?
The IUPAC name of 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid (CID 144969972) is 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid.
What is the SMILES notation for 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid?
The canonical SMILES for 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid is CN(F)C(=O)CCCCCN.NC(N)=NCCCCC(=O)O.
What is the InChIKey of 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid?
The InChIKey is LKQAHNYKLSUAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15FN2O.C6H13N3O2/c1-10(8)7(11)5-3-2-4-6-9;7-6(8)9-4-2-1-3-5(10)11/h2-6,9H2,1H3;1-4H2,(H,10,11)(H4,7,8,9).
What are the key properties of 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid?
6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid has a molecular weight of 321.40 g/mol, XLogP of 0.36, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-fluoro-N-methylhexanamide;5-(diaminomethylideneamino)pentanoic acid is sourced from PubChem (CID 144969972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).