C19H38BrN3O4 — CID 158146578
9-bromononanoic acid;9-(diaminomethylideneamino)nonanoic acid (PubChem CID 158146578) has the molecular formula C19H38BrN3O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is 9-bromononanoic acid;9-(diaminomethylideneamino)nonanoic acid.
| Compound Name | 9-bromononanoic acid;9-(diaminomethylideneamino)nonanoic acid |
|---|---|
| PubChem CID | 158146578 |
| Molecular Formula | C19H38BrN3O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 9-bromononanoic acid;9-(diaminomethylideneamino)nonanoic acid |
| SMILES | NC(N)=NCCCCCCCCC(=O)O.O=C(O)CCCCCCCCBr |
| InChI | InChI=1S/C10H21N3O2.C9H17BrO2/c11-10(12)13-8-6-4-2-1-3-5-7-9(14)15;10-8-6-4-2-1-3-5-7-9(11)12/h1-8H2,(H,14,15)(H4,11,12,13);1-8H2,(H,11,12) |
| InChIKey | FUOZVSSYROGXOK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|