C8H18N4O2 — CID 87088129
(4S)-4-amino-7-(diaminomethylideneamino)heptanoic acid (PubChem CID 87088129) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is (4S)-4-amino-7-(diaminomethylideneamino)heptanoic acid.
| Compound Name | (4S)-4-amino-7-(diaminomethylideneamino)heptanoic acid |
|---|---|
| PubChem CID | 87088129 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (4S)-4-amino-7-(diaminomethylideneamino)heptanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)CCC(=O)O |
| InChI | InChI=1S/C8H18N4O2/c9-6(3-4-7(13)14)2-1-5-12-8(10)11/h6H,1-5,9H2,(H,13,14)(H4,10,11,12)/t6-/m0/s1 |
| InChIKey | MZMVYPKOQHVKHX-LURJTMIESA-N |
| XLogP | -0.77 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|