C9H18N4O3 — CID 137349850
(5S)-5-amino-8-(diaminomethylideneamino)-4-oxooctanoic acid (PubChem CID 137349850) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is (5S)-5-amino-8-(diaminomethylideneamino)-4-oxooctanoic acid.
| Compound Name | (5S)-5-amino-8-(diaminomethylideneamino)-4-oxooctanoic acid |
|---|---|
| PubChem CID | 137349850 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (5S)-5-amino-8-(diaminomethylideneamino)-4-oxooctanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)CCC(=O)O |
| InChI | InChI=1S/C9H18N4O3/c10-6(2-1-5-13-9(11)12)7(14)3-4-8(15)16/h6H,1-5,10H2,(H,15,16)(H4,11,12,13)/t6-/m0/s1 |
| InChIKey | AVCUSSJSPSVBEK-LURJTMIESA-N |
| XLogP | -1.20 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|