C7H15ClN2O2 — CID 174613902
3-[(1-amino-2-methylpropylidene)amino]propanoic acid;hydrochloride (PubChem CID 174613902) has the molecular formula C7H15ClN2O2 and a molecular weight of 194.66 g/mol. Its IUPAC name is 3-[(1-amino-2-methylpropylidene)amino]propanoic acid;hydrochloride.
| Compound Name | 3-[(1-amino-2-methylpropylidene)amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 174613902 |
| Molecular Formula | C7H15ClN2O2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3-[(1-amino-2-methylpropylidene)amino]propanoic acid;hydrochloride |
| SMILES | CC(C)/C(N)=N/CCC(=O)O.Cl |
| InChI | InChI=1S/C7H14N2O2.ClH/c1-5(2)7(8)9-4-3-6(10)11;/h5H,3-4H2,1-2H3,(H2,8,9)(H,10,11);1H |
| InChIKey | GJMLHBBGSAASMP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|