C14H28N6O5 — CID 175948850
3-[[1-amino-3-[[3-amino-3-(2-carboxyethylimino)-2-methylpropyl]diazenyl]-2-methylpropylidene]amino]propanoic acid;hydrate (PubChem CID 175948850) has the molecular formula C14H28N6O5 and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-[[1-amino-3-[[3-amino-3-(2-carboxyethylimino)-2-methylpropyl]diazenyl]-2-methylpropylidene]amino]propanoic acid;hydrate.
| Compound Name | 3-[[1-amino-3-[[3-amino-3-(2-carboxyethylimino)-2-methylpropyl]diazenyl]-2-methylpropylidene]amino]propanoic acid;hydrate |
|---|---|
| PubChem CID | 175948850 |
| Molecular Formula | C14H28N6O5 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 3-[[1-amino-3-[[3-amino-3-(2-carboxyethylimino)-2-methylpropyl]diazenyl]-2-methylpropylidene]amino]propanoic acid;hydrate |
| SMILES | CC(C/N=N/CC(C)/C(N)=N/CCC(=O)O)/C(N)=N/CCC(=O)O.O |
| InChI | InChI=1S/C14H26N6O4.H2O/c1-9(13(15)17-5-3-11(21)22)7-19-20-8-10(2)14(16)18-6-4-12(23)24;/h9-10H,3-8H2,1-2H3,(H2,15,17)(H2,16,18)(H,21,22)(H,23,24);1H2/b20-19+; |
| InChIKey | OLODZUFHJIVWJT-RZLHGTIFSA-N |
| XLogP | -0.45 |
| TPSA | 207.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|