C6H14N4O2S — CID 118493111
3-[[amino-(2-aminoethylsulfanylamino)methylidene]amino]propanoic acid (PubChem CID 118493111) has the molecular formula C6H14N4O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-[[amino-(2-aminoethylsulfanylamino)methylidene]amino]propanoic acid.
| Compound Name | 3-[[amino-(2-aminoethylsulfanylamino)methylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 118493111 |
| Molecular Formula | C6H14N4O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-[[amino-(2-aminoethylsulfanylamino)methylidene]amino]propanoic acid |
| SMILES | NCCSN/C(N)=N/CCC(=O)O |
| InChI | InChI=1S/C6H14N4O2S/c7-2-4-13-10-6(8)9-3-1-5(11)12/h1-4,7H2,(H,11,12)(H3,8,9,10) |
| InChIKey | HZFFLOJPGQDIGW-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|