C10H19N3O4S — CID 156544480
3-[[amino-(3-carboxypropylsulfanylamino)methylidene]amino]pentanoic acid (PubChem CID 156544480) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 3-[[amino-(3-carboxypropylsulfanylamino)methylidene]amino]pentanoic acid.
| Compound Name | 3-[[amino-(3-carboxypropylsulfanylamino)methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 156544480 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-[[amino-(3-carboxypropylsulfanylamino)methylidene]amino]pentanoic acid |
| SMILES | CCC(CC(=O)O)/N=C(\N)NSCCCC(=O)O |
| InChI | InChI=1S/C10H19N3O4S/c1-2-7(6-9(16)17)12-10(11)13-18-5-3-4-8(14)15/h7H,2-6H2,1H3,(H,14,15)(H,16,17)(H3,11,12,13) |
| InChIKey | XPURYEMEGYRHKK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|