C9H18N4O4S — CID 118493112
(2R)-2-amino-4-[[N'-(1-carboxypropan-2-yl)carbamimidoyl]amino]sulfanylbutanoic acid (PubChem CID 118493112) has the molecular formula C9H18N4O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is (2R)-2-amino-4-[[N'-(1-carboxypropan-2-yl)carbamimidoyl]amino]sulfanylbutanoic acid.
| Compound Name | (2R)-2-amino-4-[[N'-(1-carboxypropan-2-yl)carbamimidoyl]amino]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 118493112 |
| Molecular Formula | C9H18N4O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (2R)-2-amino-4-[[N'-(1-carboxypropan-2-yl)carbamimidoyl]amino]sulfanylbutanoic acid |
| SMILES | CC(CC(=O)O)/N=C(\N)NSCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C9H18N4O4S/c1-5(4-7(14)15)12-9(11)13-18-3-2-6(10)8(16)17/h5-6H,2-4,10H2,1H3,(H,14,15)(H,16,17)(H3,11,12,13)/t5?,6-/m1/s1 |
| InChIKey | NRXXQZXLJATBBQ-PRJDIBJQSA-N |
| XLogP | -0.80 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|