C8H18N4O4S — CID 25151356
2-amino-4-methylsulfanylbutanoic acid;2-(diaminomethylideneamino)acetic acid (PubChem CID 25151356) has the molecular formula C8H18N4O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;2-(diaminomethylideneamino)acetic acid.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;2-(diaminomethylideneamino)acetic acid |
|---|---|
| PubChem CID | 25151356 |
| Molecular Formula | C8H18N4O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;2-(diaminomethylideneamino)acetic acid |
| SMILES | CSCCC(N)C(=O)O.NC(N)=NCC(=O)O |
| InChI | InChI=1S/C5H11NO2S.C3H7N3O2/c1-9-3-2-4(6)5(7)8;4-3(5)6-1-2(7)8/h4H,2-3,6H2,1H3,(H,7,8);1H2,(H,7,8)(H4,4,5,6) |
| InChIKey | KQTKXYODGJANQW-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|