About 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid
5-[(N'-propylcarbamimidoyl)amino]pentanoic acid (PubChem CID 163528176) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid.
Molecular Properties
| Compound Name | 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid |
| PubChem CID | 163528176 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid |
| SMILES | CCC/N=C(\N)NCCCCC(=O)O |
| InChI | InChI=1S/C9H19N3O2/c1-2-6-11-9(10)12-7-4-3-5-8(13)14/h2-7H2,1H3,(H,13,14)(H3,10,11,12) |
| InChIKey | DQQHCCLDQMCVLU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid?
The IUPAC name of 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid (CID 163528176) is 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid.
What is the SMILES notation for 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid?
The canonical SMILES for 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid is CCC/N=C(\N)NCCCCC(=O)O.
What is the InChIKey of 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid?
The InChIKey is DQQHCCLDQMCVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2/c1-2-6-11-9(10)12-7-4-3-5-8(13)14/h2-7H2,1H3,(H,13,14)(H3,10,11,12).
What are the key properties of 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid?
5-[(N'-propylcarbamimidoyl)amino]pentanoic acid has a molecular weight of 201.27 g/mol, XLogP of 0.56, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(N'-propylcarbamimidoyl)amino]pentanoic acid is sourced from PubChem (CID 163528176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).