C6H13N3O2 — CID 87703719
2-[[amino(propylamino)methylidene]amino]acetic acid (PubChem CID 87703719) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-[[amino(propylamino)methylidene]amino]acetic acid.
| Compound Name | 2-[[amino(propylamino)methylidene]amino]acetic acid |
|---|---|
| PubChem CID | 87703719 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-[[amino(propylamino)methylidene]amino]acetic acid |
| SMILES | CCCN/C(N)=N/CC(=O)O |
| InChI | InChI=1S/C6H13N3O2/c1-2-3-8-6(7)9-4-5(10)11/h2-4H2,1H3,(H,10,11)(H3,7,8,9) |
| InChIKey | WECQQPSGRSWADI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|