C9H22IN3O2S — CID 111696158
2-(2-methyl-2-methylsulfonylpropyl)-1-propylguanidine;hydroiodide (PubChem CID 111696158) has the molecular formula C9H22IN3O2S and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-(2-methyl-2-methylsulfonylpropyl)-1-propylguanidine;hydroiodide.
| Compound Name | 2-(2-methyl-2-methylsulfonylpropyl)-1-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111696158 |
| Molecular Formula | C9H22IN3O2S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2-(2-methyl-2-methylsulfonylpropyl)-1-propylguanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/CC(C)(C)S(C)(=O)=O.I |
| InChI | InChI=1S/C9H21N3O2S.HI/c1-5-6-11-8(10)12-7-9(2,3)15(4,13)14;/h5-7H2,1-4H3,(H3,10,11,12);1H |
| InChIKey | GRWOPRXIZDBZGF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|