C12H28IN3 — CID 111911367
1-propyl-2-(2,2,4-trimethylpentyl)guanidine;hydroiodide (PubChem CID 111911367) has the molecular formula C12H28IN3 and a molecular weight of 341.28 g/mol. Its IUPAC name is 1-propyl-2-(2,2,4-trimethylpentyl)guanidine;hydroiodide.
| Compound Name | 1-propyl-2-(2,2,4-trimethylpentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111911367 |
| Molecular Formula | C12H28IN3 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-propyl-2-(2,2,4-trimethylpentyl)guanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/CC(C)(C)CC(C)C.I |
| InChI | InChI=1S/C12H27N3.HI/c1-6-7-14-11(13)15-9-12(4,5)8-10(2)3;/h10H,6-9H2,1-5H3,(H3,13,14,15);1H |
| InChIKey | KAVJDFNWEHOJGB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|