C12H24N4O — CID 111752274
N-[3-[(N'-propylcarbamimidoyl)amino]propyl]cyclobutanecarboxamide (PubChem CID 111752274) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[3-[(N'-propylcarbamimidoyl)amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[(N'-propylcarbamimidoyl)amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111752274 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | N-[3-[(N'-propylcarbamimidoyl)amino]propyl]cyclobutanecarboxamide |
| SMILES | CCC/N=C(\N)NCCCNC(=O)C1CCC1 |
| InChI | InChI=1S/C12H24N4O/c1-2-7-15-12(13)16-9-4-8-14-11(17)10-5-3-6-10/h10H,2-9H2,1H3,(H,14,17)(H3,13,15,16) |
| InChIKey | DDBKWKVWBLBJQX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|