C9H21N3 — CID 63173155
N'-[2-[ethyl(methyl)amino]ethyl]-2-methylpropanimidamide (PubChem CID 63173155) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is N'-[2-[ethyl(methyl)amino]ethyl]-2-methylpropanimidamide.
| Compound Name | N'-[2-[ethyl(methyl)amino]ethyl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 63173155 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | N'-[2-[ethyl(methyl)amino]ethyl]-2-methylpropanimidamide |
| SMILES | CCN(C)CC/N=C(\N)C(C)C |
| InChI | InChI=1S/C9H21N3/c1-5-12(4)7-6-11-9(10)8(2)3/h8H,5-7H2,1-4H3,(H2,10,11) |
| InChIKey | JOROHVIMCPBCNK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|