C10H25N5O — CID 104882549
1-amino-2-[2-[ethyl(methyl)amino]ethyl]-3-(1-methoxypropan-2-yl)guanidine (PubChem CID 104882549) has the molecular formula C10H25N5O and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-amino-2-[2-[ethyl(methyl)amino]ethyl]-3-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 1-amino-2-[2-[ethyl(methyl)amino]ethyl]-3-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 104882549 |
| Molecular Formula | C10H25N5O |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.21 |
| IUPAC Name | 1-amino-2-[2-[ethyl(methyl)amino]ethyl]-3-(1-methoxypropan-2-yl)guanidine |
| SMILES | CCN(C)CC/N=C(\NN)NC(C)COC |
| InChI | InChI=1S/C10H25N5O/c1-5-15(3)7-6-12-10(14-11)13-9(2)8-16-4/h9H,5-8,11H2,1-4H3,(H2,12,13,14) |
| InChIKey | ZVJWPUKJHVZBNR-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|