C10H23N5O2 — CID 114133586
N-ethyl-2-[[hydrazinyl-(1-methoxypropan-2-ylamino)methylidene]amino]-N-methylacetamide (PubChem CID 114133586) has the molecular formula C10H23N5O2 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-ethyl-2-[[hydrazinyl-(1-methoxypropan-2-ylamino)methylidene]amino]-N-methylacetamide.
| Compound Name | N-ethyl-2-[[hydrazinyl-(1-methoxypropan-2-ylamino)methylidene]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 114133586 |
| Molecular Formula | C10H23N5O2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N-ethyl-2-[[hydrazinyl-(1-methoxypropan-2-ylamino)methylidene]amino]-N-methylacetamide |
| SMILES | CCN(C)C(=O)C/N=C(\NN)NC(C)COC |
| InChI | InChI=1S/C10H23N5O2/c1-5-15(3)9(16)6-12-10(14-11)13-8(2)7-17-4/h8H,5-7,11H2,1-4H3,(H2,12,13,14) |
| InChIKey | CXUBTZNECMKRDR-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|