C20H42N10 — CID 54095971
2-[[1-amino-1-[2-[(1-amino-2-methylpropylidene)amino]ethylimino]-2-methylpropan-2-yl]diazenyl]-N'-[2-[(1-amino-2-methylpropylidene)amino]ethyl]-2-methylpropanimidamide (PubChem CID 54095971) has the molecular formula C20H42N10 and a molecular weight of 422.63 g/mol. Its IUPAC name is 2-[[1-amino-1-[2-[(1-amino-2-methylpropylidene)amino]ethylimino]-2-methylpropan-2-yl]diazenyl]-N'-[2-[(1-amino-2-methylpropylidene)amino]ethyl]-2-methylpropanimidamide.
| Compound Name | 2-[[1-amino-1-[2-[(1-amino-2-methylpropylidene)amino]ethylimino]-2-methylpropan-2-yl]diazenyl]-N'-[2-[(1-amino-2-methylpropylidene)amino]ethyl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 54095971 |
| Molecular Formula | C20H42N10 |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | 2-[[1-amino-1-[2-[(1-amino-2-methylpropylidene)amino]ethylimino]-2-methylpropan-2-yl]diazenyl]-N'-[2-[(1-amino-2-methylpropylidene)amino]ethyl]-2-methylpropanimidamide |
| SMILES | CC(C)/C(N)=N\CC/N=C(\N)C(C)(C)/N=N/C(C)(C)/C(N)=N/CC/N=C(/N)C(C)C |
| InChI | InChI=1S/C20H42N10/c1-13(2)15(21)25-9-11-27-17(23)19(5,6)29-30-20(7,8)18(24)28-12-10-26-16(22)14(3)4/h13-14H,9-12H2,1-8H3,(H2,21,25)(H2,22,26)(H2,23,27)(H2,24,28)/b30-29+ |
| InChIKey | MXCQIYQOZOABSW-QVIHXGFCSA-N |
| XLogP | 1.74 |
| TPSA | 178.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|