C10H21N3O — CID 63177823
3-[(1-amino-2-methylpropylidene)amino]-N-propylpropanamide (PubChem CID 63177823) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-[(1-amino-2-methylpropylidene)amino]-N-propylpropanamide.
| Compound Name | 3-[(1-amino-2-methylpropylidene)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 63177823 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 3-[(1-amino-2-methylpropylidene)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CC/N=C(\N)C(C)C |
| InChI | InChI=1S/C10H21N3O/c1-4-6-12-9(14)5-7-13-10(11)8(2)3/h8H,4-7H2,1-3H3,(H2,11,13)(H,12,14) |
| InChIKey | GURFRECZAACQGU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|