methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate

C9H17NO4 — CID 170372518

IUPACmethyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate
SMILESCCCNC(=O)CC[C@@H](O)C(=O)OC
InChIInChI=1S/C9H17NO4/c1-3-6-10-8(12)5-4-7(11)9(13)14-2/h7,11H,3-6H2,1-2H3,(H,10,12)/t7-/m1/s1
InChIKeyRLCADFAQUBWJLE-SSDOTTSWSA-N
MW203.24 g/mol
LogP-0.17
Rot. Bonds6

About methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate

methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate (PubChem CID 170372518) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate.

Molecular Properties

Compound Namemethyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate
PubChem CID170372518
Molecular FormulaC9H17NO4
Molecular Weight203.24 g/mol
Exact Mass203.12
IUPAC Namemethyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate
SMILESCCCNC(=O)CC[C@@H](O)C(=O)OC
InChIInChI=1S/C9H17NO4/c1-3-6-10-8(12)5-4-7(11)9(13)14-2/h7,11H,3-6H2,1-2H3,(H,10,12)/t7-/m1/s1
InChIKeyRLCADFAQUBWJLE-SSDOTTSWSA-N
XLogP-0.17
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 5-0.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate?
The IUPAC name of methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate (CID 170372518) is methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate.
What is the SMILES notation for methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate?
The canonical SMILES for methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate is CCCNC(=O)CC[C@@H](O)C(=O)OC.
What is the InChIKey of methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate?
The InChIKey is RLCADFAQUBWJLE-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H17NO4/c1-3-6-10-8(12)5-4-7(11)9(13)14-2/h7,11H,3-6H2,1-2H3,(H,10,12)/t7-/m1/s1.
What are the key properties of methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate?
methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate has a molecular weight of 203.24 g/mol, XLogP of -0.17, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-hydroxy-5-oxo-5-(propylamino)pentanoate is sourced from PubChem (CID 170372518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).