About 2-methyl-N'-(3-phenylbutyl)propanimidamide
2-methyl-N'-(3-phenylbutyl)propanimidamide (PubChem CID 63181443) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-methyl-N'-(3-phenylbutyl)propanimidamide.
Molecular Properties
| Compound Name | 2-methyl-N'-(3-phenylbutyl)propanimidamide |
| PubChem CID | 63181443 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-methyl-N'-(3-phenylbutyl)propanimidamide |
| SMILES | CC(C)/C(N)=N\CCC(C)c1ccccc1 |
| InChI | InChI=1S/C14H22N2/c1-11(2)14(15)16-10-9-12(3)13-7-5-4-6-8-13/h4-8,11-12H,9-10H2,1-3H3,(H2,15,16) |
| InChIKey | JIYFMPNXRXYMBK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-(3-phenylbutyl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-(3-phenylbutyl)propanimidamide?
The IUPAC name of 2-methyl-N'-(3-phenylbutyl)propanimidamide (CID 63181443) is 2-methyl-N'-(3-phenylbutyl)propanimidamide.
What is the SMILES notation for 2-methyl-N'-(3-phenylbutyl)propanimidamide?
The canonical SMILES for 2-methyl-N'-(3-phenylbutyl)propanimidamide is CC(C)/C(N)=N\CCC(C)c1ccccc1.
What is the InChIKey of 2-methyl-N'-(3-phenylbutyl)propanimidamide?
The InChIKey is JIYFMPNXRXYMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2/c1-11(2)14(15)16-10-9-12(3)13-7-5-4-6-8-13/h4-8,11-12H,9-10H2,1-3H3,(H2,15,16).
What are the key properties of 2-methyl-N'-(3-phenylbutyl)propanimidamide?
2-methyl-N'-(3-phenylbutyl)propanimidamide has a molecular weight of 218.34 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-(3-phenylbutyl)propanimidamide is sourced from PubChem (CID 63181443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).