C14H23N3 — CID 55159960
2-methyl-N'-[3-(N-methylanilino)propyl]propanimidamide (PubChem CID 55159960) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-methyl-N'-[3-(N-methylanilino)propyl]propanimidamide.
| Compound Name | 2-methyl-N'-[3-(N-methylanilino)propyl]propanimidamide |
|---|---|
| PubChem CID | 55159960 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-methyl-N'-[3-(N-methylanilino)propyl]propanimidamide |
| SMILES | CC(C)/C(N)=N\CCCN(C)c1ccccc1 |
| InChI | InChI=1S/C14H23N3/c1-12(2)14(15)16-10-7-11-17(3)13-8-5-4-6-9-13/h4-6,8-9,12H,7,10-11H2,1-3H3,(H2,15,16) |
| InChIKey | RLCWYAGTQITUDM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|