C8H21N6+ — CID 146937640
[1-amino-2-[(1,1-diamino-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium (PubChem CID 146937640) has the molecular formula C8H21N6+ and a molecular weight of 201.30 g/mol. Its IUPAC name is [1-amino-2-[(1,1-diamino-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium.
| Compound Name | [1-amino-2-[(1,1-diamino-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium |
|---|---|
| PubChem CID | 146937640 |
| Molecular Formula | C8H21N6+ |
| Molecular Weight | 201.30 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | [1-amino-2-[(1,1-diamino-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium |
| SMILES | CC(C)(/N=N/C(C)(C)C(N)N)C(N)=[NH2+] |
| InChI | InChI=1S/C8H20N6/c1-7(2,5(9)10)13-14-8(3,4)6(11)12/h5H,9-10H2,1-4H3,(H3,11,12)/p+1/b14-13+ |
| InChIKey | IYDBENXYWMEDIZ-BUHFOSPRSA-O |
| XLogP | -1.64 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.30 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|