C19H39N9O2S+2 — CID 159218317
[1-amino-2-[(1-amino-1-azaniumylidene-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium;N,N-dibutyl-1,1-dicyanomethanesulfonamide (PubChem CID 159218317) has the molecular formula C19H39N9O2S+2 and a molecular weight of 457.65 g/mol. Its IUPAC name is [1-amino-2-[(1-amino-1-azaniumylidene-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium;N,N-dibutyl-1,1-dicyanomethanesulfonamide.
| Compound Name | [1-amino-2-[(1-amino-1-azaniumylidene-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium;N,N-dibutyl-1,1-dicyanomethanesulfonamide |
|---|---|
| PubChem CID | 159218317 |
| Molecular Formula | C19H39N9O2S+2 |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | [1-amino-2-[(1-amino-1-azaniumylidene-2-methylpropan-2-yl)diazenyl]-2-methylpropylidene]azanium;N,N-dibutyl-1,1-dicyanomethanesulfonamide |
| SMILES | CC(C)(/N=N/C(C)(C)C(N)=[NH2+])C(N)=[NH2+].CCCCN(CCCC)S(=O)(=O)C(C#N)C#N |
| InChI | InChI=1S/C11H19N3O2S.C8H18N6/c1-3-5-7-14(8-6-4-2)17(15,16)11(9-12)10-13;1-7(2,5(9)10)13-14-8(3,4)6(11)12/h11H,3-8H2,1-2H3;1-4H3,(H3,9,10)(H3,11,12)/p+2/b;14-13+ |
| InChIKey | KRJATFABHRAQMA-SLTJUJPSSA-P |
| XLogP | -1.14 |
| TPSA | 212.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|