C15H33NO5S2 — CID 118052252
4-(dibutylsulfamoyl)-4-methylhexane-3-sulfonic acid (PubChem CID 118052252) has the molecular formula C15H33NO5S2 and a molecular weight of 371.57 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-4-methylhexane-3-sulfonic acid.
| Compound Name | 4-(dibutylsulfamoyl)-4-methylhexane-3-sulfonic acid |
|---|---|
| PubChem CID | 118052252 |
| Molecular Formula | C15H33NO5S2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-(dibutylsulfamoyl)-4-methylhexane-3-sulfonic acid |
| SMILES | CCCCN(CCCC)S(=O)(=O)C(C)(CC)C(CC)S(=O)(=O)O |
| InChI | InChI=1S/C15H33NO5S2/c1-6-10-12-16(13-11-7-2)23(20,21)15(5,9-4)14(8-3)22(17,18)19/h14H,6-13H2,1-5H3,(H,17,18,19) |
| InChIKey | MTXUQFRMWGLPTC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|