C19H39F2NO5S2 — CID 89153415
5-[butyl(2-ethylhexyl)sulfamoyl]-4,4-difluoroheptane-3-sulfonic acid (PubChem CID 89153415) has the molecular formula C19H39F2NO5S2 and a molecular weight of 463.65 g/mol. Its IUPAC name is 5-[butyl(2-ethylhexyl)sulfamoyl]-4,4-difluoroheptane-3-sulfonic acid.
| Compound Name | 5-[butyl(2-ethylhexyl)sulfamoyl]-4,4-difluoroheptane-3-sulfonic acid |
|---|---|
| PubChem CID | 89153415 |
| Molecular Formula | C19H39F2NO5S2 |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 5-[butyl(2-ethylhexyl)sulfamoyl]-4,4-difluoroheptane-3-sulfonic acid |
| SMILES | CCCCC(CC)CN(CCCC)S(=O)(=O)C(CC)C(F)(F)C(CC)S(=O)(=O)O |
| InChI | InChI=1S/C19H39F2NO5S2/c1-6-11-13-16(8-3)15-22(14-12-7-2)28(23,24)17(9-4)19(20,21)18(10-5)29(25,26)27/h16-18H,6-15H2,1-5H3,(H,25,26,27) |
| InChIKey | GTMSHOXWXNLHLQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|