C9H12N2O — CID 145374732
(5E)-5-ethylidene-3-methyl-N-[(Z)-prop-1-enyl]-1,2-oxazol-4-imine (PubChem CID 145374732) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is (5E)-5-ethylidene-3-methyl-N-[(Z)-prop-1-enyl]-1,2-oxazol-4-imine.
| Compound Name | (5E)-5-ethylidene-3-methyl-N-[(Z)-prop-1-enyl]-1,2-oxazol-4-imine |
|---|---|
| PubChem CID | 145374732 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (5E)-5-ethylidene-3-methyl-N-[(Z)-prop-1-enyl]-1,2-oxazol-4-imine |
| SMILES | C/C=C\N=C1/C(C)=NO/C1=C/C |
| InChI | InChI=1S/C9H12N2O/c1-4-6-10-9-7(3)11-12-8(9)5-2/h4-6H,1-3H3/b6-4-,8-5+,10-9+ |
| InChIKey | RBCDHPGXWYPOCK-BGPGRFNSSA-N |
| XLogP | 2.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|