C15H19N3 — CID 142874762
(5E)-5-ethylidene-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(Z)-prop-1-enyl]-1H-imidazol-4-imine (PubChem CID 142874762) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is (5E)-5-ethylidene-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(Z)-prop-1-enyl]-1H-imidazol-4-imine.
| Compound Name | (5E)-5-ethylidene-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(Z)-prop-1-enyl]-1H-imidazol-4-imine |
|---|---|
| PubChem CID | 142874762 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (5E)-5-ethylidene-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-[(Z)-prop-1-enyl]-1H-imidazol-4-imine |
| SMILES | C=C/C=C(\C=C/C)C1=NC(=N\C=C/C)/C(=C\C)N1 |
| InChI | InChI=1S/C15H19N3/c1-5-9-12(10-6-2)14-17-13(8-4)15(18-14)16-11-7-3/h5-11H,1H2,2-4H3,(H,16,17,18)/b10-6-,11-7-,12-9+,13-8+ |
| InChIKey | RIBFMEVUURXGPB-OSEHVFPPSA-N |
| XLogP | 3.51 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|